C16H17FN6O — CID 11539492
1-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-3-(3-fluorophenyl)urea (PubChem CID 11539492) has the molecular formula C16H17FN6O and a molecular weight of 328.35 g/mol. Its IUPAC name is 1-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 11539492 |
| Molecular Formula | C16H17FN6O |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-3-(3-fluorophenyl)urea |
| SMILES | CC(C)CN(NC(=O)Nc1cccc(F)c1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C16H17FN6O/c1-11(2)10-23(15-6-7-19-14(9-18)21-15)22-16(24)20-13-5-3-4-12(17)8-13/h3-8,11H,10H2,1-2H3,(H2,20,22,24) |
| InChIKey | LXRUOPAPYVZMNU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|