C8H7N3O2 — CID 91619138
5-methyl-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole (PubChem CID 91619138) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-methyl-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91619138 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 5-methyl-3-(1-oxidopyridin-1-ium-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1nc(-c2cc[n+]([O-])cc2)no1 |
| InChI | InChI=1S/C8H7N3O2/c1-6-9-8(10-13-6)7-2-4-11(12)5-3-7/h2-5H,1H3 |
| InChIKey | JPYRQUBFINKOFS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|