C24H18F2N4O7S — CID 91636006
2-[(4E)-1-[4-(difluoromethoxy)phenyl]-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 91636006) has the molecular formula C24H18F2N4O7S and a molecular weight of 544.49 g/mol. Its IUPAC name is 2-[(4E)-1-[4-(difluoromethoxy)phenyl]-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[(4E)-1-[4-(difluoromethoxy)phenyl]-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 91636006 |
| Molecular Formula | C24H18F2N4O7S |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 2-[(4E)-1-[4-(difluoromethoxy)phenyl]-4-(furan-2-ylmethylidene)-5-oxoimidazol-2-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)CSC1=N/C(=C/c2ccco2)C(=O)N1c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H18F2N4O7S/c1-35-20-11-15(30(33)34)6-9-18(20)27-21(31)13-38-24-28-19(12-17-3-2-10-36-17)22(32)29(24)14-4-7-16(8-5-14)37-23(25)26/h2-12,23H,13H2,1H3,(H,27,31)/b19-12+ |
| InChIKey | MVRMWKFCNJIBBN-XDHOZWIPSA-N |
| XLogP | 4.91 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|