C19H22N2O4 — CID 91640664
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pyrrol-1-yloxan-4-yl)acetamide (PubChem CID 91640664) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pyrrol-1-yloxan-4-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pyrrol-1-yloxan-4-yl)acetamide |
|---|---|
| PubChem CID | 91640664 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-pyrrol-1-yloxan-4-yl)acetamide |
| SMILES | O=C(CC1(n2cccc2)CCOCC1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N2O4/c22-18(20-13-15-3-4-16-17(11-15)25-14-24-16)12-19(5-9-23-10-6-19)21-7-1-2-8-21/h1-4,7-8,11H,5-6,9-10,12-14H2,(H,20,22) |
| InChIKey | FQUUKSKWVRZAOS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |