C24H28N2O3S — CID 9164284
(E)-N-[4-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-2-phenylethenesulfonamide (PubChem CID 9164284) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is (E)-N-[4-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-2-phenylethenesulfonamide.
| Compound Name | (E)-N-[4-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 9164284 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (E)-N-[4-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carbonyl]phenyl]-2-phenylethenesulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)/C=C/c2ccccc2)cc1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C24H28N2O3S/c27-24(26-16-14-20-8-4-5-9-22(20)18-26)21-10-12-23(13-11-21)25-30(28,29)17-15-19-6-2-1-3-7-19/h1-3,6-7,10-13,15,17,20,22,25H,4-5,8-9,14,16,18H2/b17-15+/t20-,22-/m0/s1 |
| InChIKey | FVYZVCHDYKZYHG-DGQRJMBKSA-N |
| XLogP | 4.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |