C15H15FN4O — CID 91644069
1-(4-fluorophenyl)-N'-pyrazin-2-ylcyclobutane-1-carbohydrazide (PubChem CID 91644069) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N'-pyrazin-2-ylcyclobutane-1-carbohydrazide.
| Compound Name | 1-(4-fluorophenyl)-N'-pyrazin-2-ylcyclobutane-1-carbohydrazide |
|---|---|
| PubChem CID | 91644069 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(4-fluorophenyl)-N'-pyrazin-2-ylcyclobutane-1-carbohydrazide |
| SMILES | O=C(NNc1cnccn1)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C15H15FN4O/c16-12-4-2-11(3-5-12)15(6-1-7-15)14(21)20-19-13-10-17-8-9-18-13/h2-5,8-10H,1,6-7H2,(H,18,19)(H,20,21) |
| InChIKey | YAWFXAVCWNRYNM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|