C18H23ClN2O — CID 91644746
N-[1-(2-chloro-4-pyridinyl)ethyl]-3-(1-phenylethoxy)propan-1-amine (PubChem CID 91644746) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[1-(2-chloro-4-pyridinyl)ethyl]-3-(1-phenylethoxy)propan-1-amine.
| Compound Name | N-[1-(2-chloro-4-pyridinyl)ethyl]-3-(1-phenylethoxy)propan-1-amine |
|---|---|
| PubChem CID | 91644746 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[1-(2-chloro-4-pyridinyl)ethyl]-3-(1-phenylethoxy)propan-1-amine |
| SMILES | CC(NCCCOC(C)c1ccccc1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN2O/c1-14(17-9-11-21-18(19)13-17)20-10-6-12-22-15(2)16-7-4-3-5-8-16/h3-5,7-9,11,13-15,20H,6,10,12H2,1-2H3 |
| InChIKey | OPXQPEKJCVWJNK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|