C12H23N5O — CID 91648307
1,3-diethyl-2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 91648307) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 1,3-diethyl-2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1,3-diethyl-2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 91648307 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 1,3-diethyl-2-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | CCNC(=NCc1c(C)nn(C)c1OC)NCC |
| InChI | InChI=1S/C12H23N5O/c1-6-13-12(14-7-2)15-8-10-9(3)16-17(4)11(10)18-5/h6-8H2,1-5H3,(H2,13,14,15) |
| InChIKey | FUIXOBVFUHVMFK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|