C20H29NO4 — CID 91649944
N-[[2-(2,2-diethoxyethoxy)phenyl]methyl]-N-(furan-3-ylmethyl)ethanamine (PubChem CID 91649944) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[[2-(2,2-diethoxyethoxy)phenyl]methyl]-N-(furan-3-ylmethyl)ethanamine.
| Compound Name | N-[[2-(2,2-diethoxyethoxy)phenyl]methyl]-N-(furan-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 91649944 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N-[[2-(2,2-diethoxyethoxy)phenyl]methyl]-N-(furan-3-ylmethyl)ethanamine |
| SMILES | CCOC(COc1ccccc1CN(CC)Cc1ccoc1)OCC |
| InChI | InChI=1S/C20H29NO4/c1-4-21(13-17-11-12-22-15-17)14-18-9-7-8-10-19(18)25-16-20(23-5-2)24-6-3/h7-12,15,20H,4-6,13-14,16H2,1-3H3 |
| InChIKey | LFVNGVNMKBSPBH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|