C16H17N3O4S — CID 91650315
3-[1-(1-benzofuran-2-ylsulfonyl)azepan-2-yl]-1,2,4-oxadiazole (PubChem CID 91650315) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 3-[1-(1-benzofuran-2-ylsulfonyl)azepan-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[1-(1-benzofuran-2-ylsulfonyl)azepan-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 91650315 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-[1-(1-benzofuran-2-ylsulfonyl)azepan-2-yl]-1,2,4-oxadiazole |
| SMILES | O=S(=O)(c1cc2ccccc2o1)N1CCCCCC1c1ncon1 |
| InChI | InChI=1S/C16H17N3O4S/c20-24(21,15-10-12-6-3-4-8-14(12)23-15)19-9-5-1-2-7-13(19)16-17-11-22-18-16/h3-4,6,8,10-11,13H,1-2,5,7,9H2 |
| InChIKey | HBPFNYQJLXPGDK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |