About magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide
magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide (PubChem CID 91657583) has the molecular formula C13H9BrF2MgO
and a molecular weight of 323.42 g/mol. Its IUPAC name is magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide.
Molecular Properties
| Compound Name | magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide |
| PubChem CID | 91657583 |
| Molecular Formula | C13H9BrF2MgO |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide |
| SMILES | Fc1ccc(COc2c[c-]ccc2)cc1F.[Br-].[Mg+2] |
| InChI | InChI=1S/C13H9F2O.BrH.Mg/c14-12-7-6-10(8-13(12)15)9-16-11-4-2-1-3-5-11;;/h1-2,4-8H,9H2;1H;/q-1;;+2/p-1 |
| InChIKey | REBUQTDLYYZPPL-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide?
The IUPAC name of magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide (CID 91657583) is magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide.
What is the SMILES notation for magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide?
The canonical SMILES for magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide is Fc1ccc(COc2c[c-]ccc2)cc1F.[Br-].[Mg+2].
What is the InChIKey of magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide?
The InChIKey is REBUQTDLYYZPPL-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H9F2O.BrH.Mg/c14-12-7-6-10(8-13(12)15)9-16-11-4-2-1-3-5-11;;/h1-2,4-8H,9H2;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide?
magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide has a molecular weight of 323.42 g/mol, XLogP of -0.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,2-difluoro-4-(phenoxymethyl)benzene;bromide is sourced from PubChem (CID 91657583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).