C13H21N3O3S — CID 91660388
1-[(1,1-dioxothian-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine (PubChem CID 91660388) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[(1,1-dioxothian-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 91660388 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[(1,1-dioxothian-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccco1)NCC1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H21N3O3S/c1-14-13(15-9-11-5-4-7-19-11)16-10-12-6-2-3-8-20(12,17)18/h4-5,7,12H,2-3,6,8-10H2,1H3,(H2,14,15,16) |
| InChIKey | UXAQAHZPBRIPLG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|