C19H11N3O — CID 91664020
14-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,8,10,12,14-heptaen-7-one (PubChem CID 91664020) has the molecular formula C19H11N3O and a molecular weight of 297.32 g/mol. Its IUPAC name is 14-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,8,10,12,14-heptaen-7-one.
| Compound Name | 14-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,8,10,12,14-heptaen-7-one |
|---|---|
| PubChem CID | 91664020 |
| Molecular Formula | C19H11N3O |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 14-phenyl-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),3,5,8,10,12,14-heptaen-7-one |
| SMILES | O=c1nc2c(n3ccnc13)=Cc1c(-c3ccccc3)cccc1-2 |
| InChI | InChI=1S/C19H11N3O/c23-19-18-20-9-10-22(18)16-11-15-13(12-5-2-1-3-6-12)7-4-8-14(15)17(16)21-19/h1-11H |
| InChIKey | SFZNDQGUHVYHPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |