About 5H-pyrido[3,2-b]indole-7-carbonitrile
5H-pyrido[3,2-b]indole-7-carbonitrile (PubChem CID 91665984) has the molecular formula C12H7N3
and a molecular weight of 193.21 g/mol. Its IUPAC name is 5H-pyrido[3,2-b]indole-7-carbonitrile.
Molecular Properties
| Compound Name | 5H-pyrido[3,2-b]indole-7-carbonitrile |
| PubChem CID | 91665984 |
| Molecular Formula | C12H7N3 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 5H-pyrido[3,2-b]indole-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)[nH]c1cccnc12 |
| InChI | InChI=1S/C12H7N3/c13-7-8-3-4-9-11(6-8)15-10-2-1-5-14-12(9)10/h1-6,15H |
| InChIKey | PPMNKZKVWBCQLI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrido[3,2-b]indole-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrido[3,2-b]indole-7-carbonitrile?
The IUPAC name of 5H-pyrido[3,2-b]indole-7-carbonitrile (CID 91665984) is 5H-pyrido[3,2-b]indole-7-carbonitrile.
What is the SMILES notation for 5H-pyrido[3,2-b]indole-7-carbonitrile?
The canonical SMILES for 5H-pyrido[3,2-b]indole-7-carbonitrile is N#Cc1ccc2c(c1)[nH]c1cccnc12.
What is the InChIKey of 5H-pyrido[3,2-b]indole-7-carbonitrile?
The InChIKey is PPMNKZKVWBCQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3/c13-7-8-3-4-9-11(6-8)15-10-2-1-5-14-12(9)10/h1-6,15H.
What are the key properties of 5H-pyrido[3,2-b]indole-7-carbonitrile?
5H-pyrido[3,2-b]indole-7-carbonitrile has a molecular weight of 193.21 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrido[3,2-b]indole-7-carbonitrile is sourced from PubChem (CID 91665984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).