C13H8N2Se — CID 144569289
12-selena-3,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,10,13,15-heptaene (PubChem CID 144569289) has the molecular formula C13H8N2Se and a molecular weight of 271.18 g/mol. Its IUPAC name is 12-selena-3,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,10,13,15-heptaene.
| Compound Name | 12-selena-3,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,10,13,15-heptaene |
|---|---|
| PubChem CID | 144569289 |
| Molecular Formula | C13H8N2Se |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | 12-selena-3,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,10,13,15-heptaene |
| SMILES | c1cnc2c(c1)[nH]c1cc3[se]ccc3cc12 |
| InChI | InChI=1S/C13H8N2Se/c1-2-10-13(14-4-1)9-6-8-3-5-16-12(8)7-11(9)15-10/h1-7,15H |
| InChIKey | YCTNFUHSGROXGX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|