C14H14FN3 — CID 71059754
N-(3-fluoropropyl)-5H-pyrido[3,2-b]indol-7-amine (PubChem CID 71059754) has the molecular formula C14H14FN3 and a molecular weight of 243.28 g/mol. Its IUPAC name is N-(3-fluoropropyl)-5H-pyrido[3,2-b]indol-7-amine.
| Compound Name | N-(3-fluoropropyl)-5H-pyrido[3,2-b]indol-7-amine |
|---|---|
| PubChem CID | 71059754 |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-(3-fluoropropyl)-5H-pyrido[3,2-b]indol-7-amine |
| SMILES | FCCCNc1ccc2c(c1)[nH]c1cccnc12 |
| InChI | InChI=1S/C14H14FN3/c15-6-2-8-16-10-4-5-11-13(9-10)18-12-3-1-7-17-14(11)12/h1,3-5,7,9,16,18H,2,6,8H2 |
| InChIKey | XZWVFGCQAWNKBQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|