C32H26N2O5 — CID 91667807
ethyl 4-[7-(4-ethoxycarbonylphenyl)-2-(4-formylphenyl)-3H-benzimidazol-4-yl]benzoate (PubChem CID 91667807) has the molecular formula C32H26N2O5 and a molecular weight of 518.57 g/mol. Its IUPAC name is ethyl 4-[7-(4-ethoxycarbonylphenyl)-2-(4-formylphenyl)-3H-benzimidazol-4-yl]benzoate.
| Compound Name | ethyl 4-[7-(4-ethoxycarbonylphenyl)-2-(4-formylphenyl)-3H-benzimidazol-4-yl]benzoate |
|---|---|
| PubChem CID | 91667807 |
| Molecular Formula | C32H26N2O5 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | ethyl 4-[7-(4-ethoxycarbonylphenyl)-2-(4-formylphenyl)-3H-benzimidazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(-c3ccc(C(=O)OCC)cc3)c3[nH]c(-c4ccc(C=O)cc4)nc23)cc1 |
| InChI | InChI=1S/C32H26N2O5/c1-3-38-31(36)24-13-9-21(10-14-24)26-17-18-27(22-11-15-25(16-12-22)32(37)39-4-2)29-28(26)33-30(34-29)23-7-5-20(19-35)6-8-23/h5-19H,3-4H2,1-2H3,(H,33,34) |
| InChIKey | QQYQPYHQQRLTLT-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|