C24H20N2O5 — CID 157076592
4-(1H-benzimidazol-2-yl)benzoic acid;ethyl 4-formylbenzoate (PubChem CID 157076592) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)benzoic acid;ethyl 4-formylbenzoate.
| Compound Name | 4-(1H-benzimidazol-2-yl)benzoic acid;ethyl 4-formylbenzoate |
|---|---|
| PubChem CID | 157076592 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)benzoic acid;ethyl 4-formylbenzoate |
| SMILES | CCOC(=O)c1ccc(C=O)cc1.O=C(O)c1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C14H10N2O2.C10H10O3/c17-14(18)10-7-5-9(6-8-10)13-15-11-3-1-2-4-12(11)16-13;1-2-13-10(12)9-5-3-8(7-11)4-6-9/h1-8H,(H,15,16)(H,17,18);3-7H,2H2,1H3 |
| InChIKey | ADARTJLSCSCQJM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|