C18H23BrFN2O2+ — CID 9167678
(E)-3-(5-bromo-2-fluorophenyl)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9167678) has the molecular formula C18H23BrFN2O2+ and a molecular weight of 398.30 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9167678 |
| Molecular Formula | C18H23BrFN2O2+ |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-1-[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)N1CC[NH+](C[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C18H22BrFN2O2/c19-15-4-5-17(20)14(12-15)3-6-18(23)22-9-7-21(8-10-22)13-16-2-1-11-24-16/h3-6,12,16H,1-2,7-11,13H2/p+1/b6-3+/t16-/m0/s1 |
| InChIKey | ORCRMGOCSUAHPM-GIZXNFQBSA-O |
| XLogP | 1.51 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|