C10H8F2N6O3S — CID 91685738
2-[[4-amino-5-(difluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide (PubChem CID 91685738) has the molecular formula C10H8F2N6O3S and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-[[4-amino-5-(difluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide.
| Compound Name | 2-[[4-amino-5-(difluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 91685738 |
| Molecular Formula | C10H8F2N6O3S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[[4-amino-5-(difluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrobenzamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])ccc1Sc1nnc(C(F)F)n1N |
| InChI | InChI=1S/C10H8F2N6O3S/c11-7(12)9-15-16-10(17(9)14)22-6-2-1-4(18(20)21)3-5(6)8(13)19/h1-3,7H,14H2,(H2,13,19) |
| InChIKey | YVRJIIRFRIBIEL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|