C26H28N4O4S — CID 42629090
2-[4-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]phenyl]sulfanyl-5-nitrobenzamide (PubChem CID 42629090) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[4-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]phenyl]sulfanyl-5-nitrobenzamide.
| Compound Name | 2-[4-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]phenyl]sulfanyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 42629090 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[4-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]phenyl]sulfanyl-5-nitrobenzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])cc2C(N)=O)cc1 |
| InChI | InChI=1S/C26H28N4O4S/c1-15(2)20-6-5-7-21(16(3)4)24(20)29-26(32)28-17-8-11-19(12-9-17)35-23-13-10-18(30(33)34)14-22(23)25(27)31/h5-16H,1-4H3,(H2,27,31)(H2,28,29,32) |
| InChIKey | YQEZIXYXQLHLFS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|