C26H17Cl2NO3S — CID 91689756
(E)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]-1-(2-chlorophenothiazin-10-yl)prop-2-en-1-one (PubChem CID 91689756) has the molecular formula C26H17Cl2NO3S and a molecular weight of 494.40 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]-1-(2-chlorophenothiazin-10-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]-1-(2-chlorophenothiazin-10-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91689756 |
| Molecular Formula | C26H17Cl2NO3S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]-1-(2-chlorophenothiazin-10-yl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2ccc(/C=C/C(=O)N3c4ccccc4Sc4ccc(Cl)cc43)o2)cc1Cl |
| InChI | InChI=1S/C26H17Cl2NO3S/c1-31-23-10-6-16(14-19(23)28)22-11-8-18(32-22)9-13-26(30)29-20-4-2-3-5-24(20)33-25-12-7-17(27)15-21(25)29/h2-15H,1H3/b13-9+ |
| InChIKey | MEENGNPBJHEABQ-UKTHLTGXSA-N |
| XLogP | 8.10 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|