C23H34O5 — CID 91692102
[(5R,8R,9S,10S,13R,14R)-17-acetyl-14,15-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 91692102) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(5R,8R,9S,10S,13R,14R)-17-acetyl-14,15-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(5R,8R,9S,10S,13R,14R)-17-acetyl-14,15-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 91692102 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(5R,8R,9S,10S,13R,14R)-17-acetyl-14,15-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(C(C)=O)=CC(O)[C@@]32O)C1 |
| InChI | InChI=1S/C23H34O5/c1-13(24)19-12-20(26)23(27)18-6-5-15-11-16(28-14(2)25)7-9-21(15,3)17(18)8-10-22(19,23)4/h12,15-18,20,26-27H,5-11H2,1-4H3/t15-,16?,17+,18-,20?,21+,22-,23+/m1/s1 |
| InChIKey | NEWHUCRTZBVVFW-HJHWXHNHSA-N |
| XLogP | 3.17 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |