C14H16ClN5O2 — CID 91697477
ethyl (E)-3-[(5-amino-1-phenyl-1,2,4-triazol-3-yl)amino]-2-chlorobut-2-enoate (PubChem CID 91697477) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is ethyl (E)-3-[(5-amino-1-phenyl-1,2,4-triazol-3-yl)amino]-2-chlorobut-2-enoate.
| Compound Name | ethyl (E)-3-[(5-amino-1-phenyl-1,2,4-triazol-3-yl)amino]-2-chlorobut-2-enoate |
|---|---|
| PubChem CID | 91697477 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | ethyl (E)-3-[(5-amino-1-phenyl-1,2,4-triazol-3-yl)amino]-2-chlorobut-2-enoate |
| SMILES | CCOC(=O)/C(Cl)=C(/C)Nc1nc(N)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-3-22-12(21)11(15)9(2)17-14-18-13(16)20(19-14)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3,(H3,16,17,18,19)/b11-9+ |
| InChIKey | WJYXXMGBYAJNAX-PKNBQFBNSA-N |
| XLogP | 2.29 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|