C13H22F8O2Si — CID 91698245
dimethyl-(4-methylpentoxy)-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane (PubChem CID 91698245) has the molecular formula C13H22F8O2Si and a molecular weight of 390.39 g/mol. Its IUPAC name is dimethyl-(4-methylpentoxy)-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane.
| Compound Name | dimethyl-(4-methylpentoxy)-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
|---|---|
| PubChem CID | 91698245 |
| Molecular Formula | C13H22F8O2Si |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | dimethyl-(4-methylpentoxy)-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
| SMILES | CC(C)CCCO[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H22F8O2Si/c1-9(2)6-5-7-22-24(3,4)23-8-11(16,17)13(20,21)12(18,19)10(14)15/h9-10H,5-8H2,1-4H3 |
| InChIKey | PHZCINNPDUSJAN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|