C11H18F8OSi — CID 91697458
tert-butyl-dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane (PubChem CID 91697458) has the molecular formula C11H18F8OSi and a molecular weight of 346.33 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
|---|---|
| PubChem CID | 91697458 |
| Molecular Formula | C11H18F8OSi |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | tert-butyl-dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H18F8OSi/c1-8(2,3)21(4,5)20-6-9(14,15)11(18,19)10(16,17)7(12)13/h7H,6H2,1-5H3 |
| InChIKey | GOTVRIWFQPPZCB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|