C12H20F8O2Si — CID 91694860
dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)-pentoxysilane (PubChem CID 91694860) has the molecular formula C12H20F8O2Si and a molecular weight of 376.36 g/mol. Its IUPAC name is dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)-pentoxysilane.
| Compound Name | dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)-pentoxysilane |
|---|---|
| PubChem CID | 91694860 |
| Molecular Formula | C12H20F8O2Si |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | dimethyl-(2,2,3,3,4,4,5,5-octafluoropentoxy)-pentoxysilane |
| SMILES | CCCCCO[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H20F8O2Si/c1-4-5-6-7-21-23(2,3)22-8-10(15,16)12(19,20)11(17,18)9(13)14/h9H,4-8H2,1-3H3 |
| InChIKey | RMZBZDJCQLGBCZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|