C8H11F9OSi — CID 13179203
trimethyl(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)silane (PubChem CID 13179203) has the molecular formula C8H11F9OSi and a molecular weight of 322.24 g/mol. Its IUPAC name is trimethyl(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)silane.
| Compound Name | trimethyl(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)silane |
|---|---|
| PubChem CID | 13179203 |
| Molecular Formula | C8H11F9OSi |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | trimethyl(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F9OSi/c1-19(2,3)18-4-5(9,10)6(11,12)7(13,14)8(15,16)17/h4H2,1-3H3 |
| InChIKey | OWOOOTRKWIVQKN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|