C11H19F7O3Si — CID 19078826
triethoxy(1,2,2,3,4,5,5-heptafluoropentyl)silane (PubChem CID 19078826) has the molecular formula C11H19F7O3Si and a molecular weight of 360.34 g/mol. Its IUPAC name is triethoxy(1,2,2,3,4,5,5-heptafluoropentyl)silane.
| Compound Name | triethoxy(1,2,2,3,4,5,5-heptafluoropentyl)silane |
|---|---|
| PubChem CID | 19078826 |
| Molecular Formula | C11H19F7O3Si |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | triethoxy(1,2,2,3,4,5,5-heptafluoropentyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C11H19F7O3Si/c1-4-19-22(20-5-2,21-6-3)10(16)11(17,18)8(13)7(12)9(14)15/h7-10H,4-6H2,1-3H3 |
| InChIKey | YZCVIZULKWLQSH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|