C10H18F6O2Si — CID 141288316
2,2,3,5,5,5-hexafluoropentoxy-methoxy-methyl-propylsilane (PubChem CID 141288316) has the molecular formula C10H18F6O2Si and a molecular weight of 312.33 g/mol. Its IUPAC name is 2,2,3,5,5,5-hexafluoropentoxy-methoxy-methyl-propylsilane.
| Compound Name | 2,2,3,5,5,5-hexafluoropentoxy-methoxy-methyl-propylsilane |
|---|---|
| PubChem CID | 141288316 |
| Molecular Formula | C10H18F6O2Si |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2,2,3,5,5,5-hexafluoropentoxy-methoxy-methyl-propylsilane |
| SMILES | CCC[Si](C)(OC)OCC(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C10H18F6O2Si/c1-4-5-19(3,17-2)18-7-9(12,13)8(11)6-10(14,15)16/h8H,4-7H2,1-3H3 |
| InChIKey | LZAXZDSIVFDBAL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|