C29H48O4 — CID 91700453
bis(1-cyclohex-2-en-1-ylhexan-3-yl) pentanedioate (PubChem CID 91700453) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is bis(1-cyclohex-2-en-1-ylhexan-3-yl) pentanedioate.
| Compound Name | bis(1-cyclohex-2-en-1-ylhexan-3-yl) pentanedioate |
|---|---|
| PubChem CID | 91700453 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | bis(1-cyclohex-2-en-1-ylhexan-3-yl) pentanedioate |
| SMILES | CCCC(CCC1C=CCCC1)OC(=O)CCCC(=O)OC(CCC)CCC1C=CCCC1 |
| InChI | InChI=1S/C29H48O4/c1-3-12-26(22-20-24-14-7-5-8-15-24)32-28(30)18-11-19-29(31)33-27(13-4-2)23-21-25-16-9-6-10-17-25/h7,9,14,16,24-27H,3-6,8,10-13,15,17-23H2,1-2H3 |
| InChIKey | MLGJUOQVXOIHTH-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|