C22H30F8O4 — CID 91700450
5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate (PubChem CID 91700450) has the molecular formula C22H30F8O4 and a molecular weight of 510.46 g/mol. Its IUPAC name is 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate.
| Compound Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
|---|---|
| PubChem CID | 91700450 |
| Molecular Formula | C22H30F8O4 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3,4,4,5,5-octafluoropentyl) pentanedioate |
| SMILES | CCCC(CCC1C=CCCC1)OC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C22H30F8O4/c1-2-7-16(13-12-15-8-4-3-5-9-15)34-18(32)11-6-10-17(31)33-14-20(25,26)22(29,30)21(27,28)19(23)24/h4,8,15-16,19H,2-3,5-7,9-14H2,1H3 |
| InChIKey | TZJGDXCTZGFXHQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|