C15H21F3O4 — CID 91700438
1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (PubChem CID 91700438) has the molecular formula C15H21F3O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
| Compound Name | 1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
|---|---|
| PubChem CID | 91700438 |
| Molecular Formula | C15H21F3O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-O-(cyclohex-3-en-1-ylmethyl) 5-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| SMILES | CC(OC(=O)CCCC(=O)OCC1CC=CCC1)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O4/c1-11(15(16,17)18)22-14(20)9-5-8-13(19)21-10-12-6-3-2-4-7-12/h2-3,11-12H,4-10H2,1H3 |
| InChIKey | SFSSQDJQFLXWMA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|