C20H31F3O4 — CID 91700448
5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(1,1,1-trifluoropropan-2-yl) pentanedioate (PubChem CID 91700448) has the molecular formula C20H31F3O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(1,1,1-trifluoropropan-2-yl) pentanedioate.
| Compound Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
|---|---|
| PubChem CID | 91700448 |
| Molecular Formula | C20H31F3O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(1,1,1-trifluoropropan-2-yl) pentanedioate |
| SMILES | CCCC(CCC1C=CCCC1)OC(=O)CCCC(=O)OC(C)C(F)(F)F |
| InChI | InChI=1S/C20H31F3O4/c1-3-8-17(14-13-16-9-5-4-6-10-16)27-19(25)12-7-11-18(24)26-15(2)20(21,22)23/h5,9,15-17H,3-4,6-8,10-14H2,1-2H3 |
| InChIKey | VILHNBUYVUTLEO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|