C20H30F4O4 — CID 91700449
5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate (PubChem CID 91700449) has the molecular formula C20H30F4O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate.
| Compound Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
|---|---|
| PubChem CID | 91700449 |
| Molecular Formula | C20H30F4O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) pentanedioate |
| SMILES | CCCC(CCC1C=CCCC1)OC(=O)CCCC(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C20H30F4O4/c1-2-7-16(13-12-15-8-4-3-5-9-15)28-18(26)11-6-10-17(25)27-14-20(23,24)19(21)22/h4,8,15-16,19H,2-3,5-7,9-14H2,1H3 |
| InChIKey | IVFVVYBDFIDZTQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|