C22H26N2O2 — CID 91703930
2-[4-(diethylamino)phenyl]imino-4-methyl-1-phenylpentane-1,3-dione (PubChem CID 91703930) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]imino-4-methyl-1-phenylpentane-1,3-dione.
| Compound Name | 2-[4-(diethylamino)phenyl]imino-4-methyl-1-phenylpentane-1,3-dione |
|---|---|
| PubChem CID | 91703930 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]imino-4-methyl-1-phenylpentane-1,3-dione |
| SMILES | CCN(CC)c1ccc(/N=C(/C(=O)c2ccccc2)C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-5-24(6-2)19-14-12-18(13-15-19)23-20(21(25)16(3)4)22(26)17-10-8-7-9-11-17/h7-16H,5-6H2,1-4H3/b23-20+ |
| InChIKey | YDHDEMRPOXTKIM-BSYVCWPDSA-N |
| XLogP | 4.71 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|