C19H19ClFNO4 — CID 91704036
6-O-(2-chloro-6-fluorophenyl) 2-O-hexyl pyridine-2,6-dicarboxylate (PubChem CID 91704036) has the molecular formula C19H19ClFNO4 and a molecular weight of 379.82 g/mol. Its IUPAC name is 6-O-(2-chloro-6-fluorophenyl) 2-O-hexyl pyridine-2,6-dicarboxylate.
| Compound Name | 6-O-(2-chloro-6-fluorophenyl) 2-O-hexyl pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 91704036 |
| Molecular Formula | C19H19ClFNO4 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 6-O-(2-chloro-6-fluorophenyl) 2-O-hexyl pyridine-2,6-dicarboxylate |
| SMILES | CCCCCCOC(=O)c1cccc(C(=O)Oc2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C19H19ClFNO4/c1-2-3-4-5-12-25-18(23)15-10-7-11-16(22-15)19(24)26-17-13(20)8-6-9-14(17)21/h6-11H,2-5,12H2,1H3 |
| InChIKey | VJWCAUYOIIAIDF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|