C15H12F6OSi — CID 91704486
(3-fluorophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 91704486) has the molecular formula C15H12F6OSi and a molecular weight of 350.33 g/mol. Its IUPAC name is (3-fluorophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | (3-fluorophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 91704486 |
| Molecular Formula | C15H12F6OSi |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (3-fluorophenyl)methoxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C[Si](C)(OCc1cccc(F)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H12F6OSi/c1-23(2,22-7-8-4-3-5-9(16)6-8)15-13(20)11(18)10(17)12(19)14(15)21/h3-6H,7H2,1-2H3 |
| InChIKey | DKGQCZODRTUHSS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|