C17H20Cl2N3OS+ — CID 9170683
(3-carbamoyl-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3,4-dichlorophenyl)methyl]-methylazanium (PubChem CID 9170683) has the molecular formula C17H20Cl2N3OS+ and a molecular weight of 385.34 g/mol. Its IUPAC name is (3-carbamoyl-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3,4-dichlorophenyl)methyl]-methylazanium.
| Compound Name | (3-carbamoyl-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3,4-dichlorophenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9170683 |
| Molecular Formula | C17H20Cl2N3OS+ |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (3-carbamoyl-4,6-dimethyl-2-sulfanylidene-1-pyridinyl)methyl-[(3,4-dichlorophenyl)methyl]-methylazanium |
| SMILES | Cc1cc(C)n(C[NH+](C)Cc2ccc(Cl)c(Cl)c2)c(=S)c1C(N)=O |
| InChI | InChI=1S/C17H19Cl2N3OS/c1-10-6-11(2)22(17(24)15(10)16(20)23)9-21(3)8-12-4-5-13(18)14(19)7-12/h4-7H,8-9H2,1-3H3,(H2,20,23)/p+1 |
| InChIKey | OVXABZKAOPJQMJ-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 52.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|