C16H18N4O3S3 — CID 9171400
N-[5-[2-[5-(2-amino-2-oxoethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide (PubChem CID 9171400) has the molecular formula C16H18N4O3S3 and a molecular weight of 410.55 g/mol. Its IUPAC name is N-[5-[2-[5-(2-amino-2-oxoethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide.
| Compound Name | N-[5-[2-[5-(2-amino-2-oxoethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 9171400 |
| Molecular Formula | C16H18N4O3S3 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-[5-[2-[5-(2-amino-2-oxoethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-N-cyclopropylpropanamide |
| SMILES | CCC(=O)N(c1nnc(SCC(=O)c2ccc(CC(N)=O)s2)s1)C1CC1 |
| InChI | InChI=1S/C16H18N4O3S3/c1-2-14(23)20(9-3-4-9)15-18-19-16(26-15)24-8-11(21)12-6-5-10(25-12)7-13(17)22/h5-6,9H,2-4,7-8H2,1H3,(H2,17,22) |
| InChIKey | AGFSCKHDOOPHLP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|