C18H18N4OS2 — CID 16580465
N-cyclopropyl-N-[5-(quinolin-8-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 16580465) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-(quinolin-8-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-(quinolin-8-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 16580465 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-cyclopropyl-N-[5-(quinolin-8-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(SCc2cccc3cccnc23)s1)C1CC1 |
| InChI | InChI=1S/C18H18N4OS2/c1-2-15(23)22(14-8-9-14)17-20-21-18(25-17)24-11-13-6-3-5-12-7-4-10-19-16(12)13/h3-7,10,14H,2,8-9,11H2,1H3 |
| InChIKey | MBJPVWOZMYMWAV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|