C18H17FN4O2S2 — CID 24668379
N-cyclopropyl-N-[5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 24668379) has the molecular formula C18H17FN4O2S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 24668379 |
| Molecular Formula | C18H17FN4O2S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | N-cyclopropyl-N-[5-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(SCc2coc(-c3ccc(F)cc3)n2)s1)C1CC1 |
| InChI | InChI=1S/C18H17FN4O2S2/c1-2-15(24)23(14-7-8-14)17-21-22-18(27-17)26-10-13-9-25-16(20-13)11-3-5-12(19)6-4-11/h3-6,9,14H,2,7-8,10H2,1H3 |
| InChIKey | UPUGNGPZELHZKY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|