C19H20N4O3S2 — CID 18131856
N-cyclopropyl-N-[5-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 18131856) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-cyclopropyl-N-[5-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 18131856 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-cyclopropyl-N-[5-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)N(c1nnc(SCc2cc(-c3ccccc3OC)no2)s1)C1CC1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-3-17(24)23(12-8-9-12)18-20-21-19(28-18)27-11-13-10-15(22-26-13)14-6-4-5-7-16(14)25-2/h4-7,10,12H,3,8-9,11H2,1-2H3 |
| InChIKey | UVBAJZCGHZARHN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|