C15H16Cl2O4 — CID 91714980
1-O-(2,2-dichloroethyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate (PubChem CID 91714980) has the molecular formula C15H16Cl2O4 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1-O-(2,2-dichloroethyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate.
| Compound Name | 1-O-(2,2-dichloroethyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 91714980 |
| Molecular Formula | C15H16Cl2O4 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-O-(2,2-dichloroethyl) 4-O-(1-phenylpropyl) (E)-but-2-enedioate |
| SMILES | CCC(OC(=O)/C=C/C(=O)OCC(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C15H16Cl2O4/c1-2-12(11-6-4-3-5-7-11)21-15(19)9-8-14(18)20-10-13(16)17/h3-9,12-13H,2,10H2,1H3/b9-8+ |
| InChIKey | LJAZILGVFMIGHS-CMDGGOBGSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|