C12H4F11NO2 — CID 91715742
2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)-N-(2,2,3,3,3-pentafluoropropanoyl)propanamide (PubChem CID 91715742) has the molecular formula C12H4F11NO2 and a molecular weight of 403.15 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)-N-(2,2,3,3,3-pentafluoropropanoyl)propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)-N-(2,2,3,3,3-pentafluoropropanoyl)propanamide |
|---|---|
| PubChem CID | 91715742 |
| Molecular Formula | C12H4F11NO2 |
| Molecular Weight | 403.15 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-(4-fluorophenyl)-N-(2,2,3,3,3-pentafluoropropanoyl)propanamide |
| SMILES | O=C(N(C(=O)C(F)(F)C(F)(F)F)c1ccc(F)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4F11NO2/c13-5-1-3-6(4-2-5)24(7(25)9(14,15)11(18,19)20)8(26)10(16,17)12(21,22)23/h1-4H |
| InChIKey | BBKRONNCKNFRGG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|