C16H29N — CID 91721002
(6Z)-8-methyl-6-(2-methylhexylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine (PubChem CID 91721002) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (6Z)-8-methyl-6-(2-methylhexylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine.
| Compound Name | (6Z)-8-methyl-6-(2-methylhexylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 91721002 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (6Z)-8-methyl-6-(2-methylhexylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine |
| SMILES | CCCCC(C)/C=C1/CC(C)C2CCCN2C1 |
| InChI | InChI=1S/C16H29N/c1-4-5-7-13(2)10-15-11-14(3)16-8-6-9-17(16)12-15/h10,13-14,16H,4-9,11-12H2,1-3H3/b15-10- |
| InChIKey | YNGBOEUCIOIIQX-GDNBJRDFSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|