C13H15F3O3 — CID 91730300
3-methylbutan-2-yl 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 91730300) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is 3-methylbutan-2-yl 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | 3-methylbutan-2-yl 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 91730300 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-methylbutan-2-yl 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | COc1c(F)c(F)cc(C(=O)OC(C)C(C)C)c1F |
| InChI | InChI=1S/C13H15F3O3/c1-6(2)7(3)19-13(17)8-5-9(14)11(16)12(18-4)10(8)15/h5-7H,1-4H3 |
| InChIKey | FYPUOUBIXLJJJI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|