C21H31F3O3 — CID 91730357
tridecan-5-yl 2,4,5-trifluoro-3-methoxybenzoate (PubChem CID 91730357) has the molecular formula C21H31F3O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is tridecan-5-yl 2,4,5-trifluoro-3-methoxybenzoate.
| Compound Name | tridecan-5-yl 2,4,5-trifluoro-3-methoxybenzoate |
|---|---|
| PubChem CID | 91730357 |
| Molecular Formula | C21H31F3O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | tridecan-5-yl 2,4,5-trifluoro-3-methoxybenzoate |
| SMILES | CCCCCCCCC(CCCC)OC(=O)c1cc(F)c(F)c(OC)c1F |
| InChI | InChI=1S/C21H31F3O3/c1-4-6-8-9-10-11-13-15(12-7-5-2)27-21(25)16-14-17(22)19(24)20(26-3)18(16)23/h14-15H,4-13H2,1-3H3 |
| InChIKey | SFOBYSWKHYZLLV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|