C25H27F3O2Si — CID 91732755
heptoxy-diphenyl-(2,3,4-trifluorophenoxy)silane (PubChem CID 91732755) has the molecular formula C25H27F3O2Si and a molecular weight of 444.57 g/mol. Its IUPAC name is heptoxy-diphenyl-(2,3,4-trifluorophenoxy)silane.
| Compound Name | heptoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
|---|---|
| PubChem CID | 91732755 |
| Molecular Formula | C25H27F3O2Si |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | heptoxy-diphenyl-(2,3,4-trifluorophenoxy)silane |
| SMILES | CCCCCCCO[Si](Oc1ccc(F)c(F)c1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27F3O2Si/c1-2-3-4-5-12-19-29-31(20-13-8-6-9-14-20,21-15-10-7-11-16-21)30-23-18-17-22(26)24(27)25(23)28/h6-11,13-18H,2-5,12,19H2,1H3 |
| InChIKey | UHGIGRGZNIGLJH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|