C10H5F14NO3 — CID 91736150
2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91736150) has the molecular formula C10H5F14NO3 and a molecular weight of 453.13 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91736150 |
| Molecular Formula | C10H5F14NO3 |
| Molecular Weight | 453.13 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(NCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F14NO3/c11-5(12,7(15,16)9(19,20)21)3(26)25-1-2-28-4(27)6(13,14)8(17,18)10(22,23)24/h1-2H2,(H,25,26) |
| InChIKey | WESDPPGDTBHHKN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.13 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|